Azlocillin sodium
Catalog No: FT-0602888
CAS No: 37091-65-9
- Chemical Name: Azlocillin sodium
- Molecular Formula: C20H22N5NaO6S
- Molecular Weight: 483.5
- InChI Key: UVOCNBWUHNCKJM-XFAPPKAWSA-M
- InChI: InChI=1S/C20H23N5O6S.Na/c1-20(2)13(17(28)29)25-15(27)12(16(25)32-20)22-14(26)11(10-6-4-3-5-7-10)23-19(31)24-9-8-21-18(24)30;/h3-7,11-13,16H,8-9H2,1-2H3,(H,21,30)(H,22,26)(H,23,31)(H,28,29);/q;+1/p-1/t11-,12-,13+,16-;/m1./s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 483.473 |
| Density: | N/A |
| CAS: | 37091-65-9 |
| Bolling_Point: | N/A |
| Product_Name: | Azlocillin sodium |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C20H22N5NaO6S |
| PSA: | 176.28000 |
|---|---|
| MF: | C20H22N5NaO6S |
| FW: | 483.473 |
| Exact_Mass: | 483.118835 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| RTECS: | XH9250000 |
| Risk_Statements(EU): | R42/43 |
| Safety_Statements: | S36 |
| Symbol: | Danger |
| Warning_Statement: | P261-P280-P342 + P311 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn:Harmful |
| HS_Code: | 2942000000 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)