2-Chloro-6-methyl-1,3-benzothiazole
Catalog No: FT-0680999
CAS No: 3507-26-4
- Chemical Name: 2-Chloro-6-methyl-1,3-benzothiazole
- Molecular Formula: C8H6ClNS
- Molecular Weight: 183.66
- InChI Key: PAKSGYIFUVNJQF-UHFFFAOYSA-N
- InChI: InChI=1S/C8H6ClNS/c1-5-2-3-6-7(4-5)11-8(9)10-6/h2-4H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 183.658 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 3507-26-4 |
| Bolling_Point: | 268.4±9.0 °C at 760 mmHg |
| Product_Name: | 2-chloro-6-methylbenzo[d]thiazole |
| Melting_Point: | 44-49ºC |
| Flash_Point: | 116.1±18.7 °C |
| MF: | C8H6ClNS |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 3.87 |
| Flash_Point: | 116.1±18.7 °C |
| Melting_Point: | 44-49ºC |
| FW: | 183.658 |
| PSA: | 41.13000 |
| Exact_Mass: | 182.990952 |
| MF: | C8H6ClNS |
| Bolling_Point: | 268.4±9.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Refractive_Index: | 1.671 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R22;R36 |
| Safety_Statements: | 26 |
| Symbol: | Warning |
| Warning_Statement: | P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)