isorhapontigenin
Catalog No: FT-0656349
CAS No: 32507-66-7
- Chemical Name: isorhapontigenin
- Molecular Formula: C15H14O4
- Molecular Weight: 258.27
- InChI Key: ANNNBEZJTNCXHY-NSCUHMNNSA-N
- InChI: InChI=1S/C15H14O4/c1-19-15-8-10(4-5-14(15)18)2-3-11-6-12(16)9-13(17)7-11/h2-9,16-18H,1H3/b3-2+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 258.269 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 32507-66-7 |
| Bolling_Point: | 471.8±35.0 °C at 760 mmHg |
| Product_Name: | Isorhapontigenin |
| Melting_Point: | 182 - 184ºC |
| Flash_Point: | 239.1±25.9 °C |
| MF: | C15H14O4 |
| LogP: | 2.90 |
|---|---|
| Flash_Point: | 239.1±25.9 °C |
| Refractive_Index: | 1.722 |
| FW: | 258.269 |
| Bolling_Point: | 471.8±35.0 °C at 760 mmHg |
| Density: | 1.3±0.1 g/cm3 |
| Melting_Point: | 182 - 184ºC |
| PSA: | 69.92000 |
| Exact_Mass: | 258.089203 |
| Vapor_Pressure: | 0.0±1.2 mmHg at 25°C |
| MF: | C15H14O4 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H315-H318-H335 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2909499000 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)