![8-Chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-one (CAS: 31251-41-9) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0638960.png "8-Chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-one chemical structure")
8-Chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-one
Catalog No: FT-0638960
CAS No: 31251-41-9
- Chemical Name: 8-Chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-one
- Molecular Formula: C14H10ClNO
- Molecular Weight: 243.69
- InChI Key: WMQNOYVVLMIZDV-UHFFFAOYSA-N
- InChI: InChI=1S/C14H10ClNO/c15-11-5-6-12-10(8-11)4-3-9-2-1-7-16-13(9)14(12)17/h1-2,5-8H,3-4H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | Loratadine Impurity 2 |
|---|---|
| Flash_Point: | 216ºC |
| Melting_Point: | 90-92ºC |
| FW: | 243.68800 |
| Density: | 1.313g/cm3 |
| CAS: | 31251-41-9 |
| Bolling_Point: | 433.6ºC at 760mmHg |
| MF: | C14H10ClNO |
| Density: | 1.313g/cm3 |
|---|---|
| LogP: | 3.06460 |
| Flash_Point: | 216ºC |
| Melting_Point: | 90-92ºC |
| FW: | 243.68800 |
| PSA: | 29.96000 |
| Exact_Mass: | 243.04500 |
| MF: | C14H10ClNO |
| Bolling_Point: | 433.6ºC at 760mmHg |
| Refractive_Index: | 1.632 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)