Arabinofuranosyluracil
Catalog No: FT-0601495
CAS No: 3083-77-0
- Chemical Name: Arabinofuranosyluracil
- Molecular Formula: C9H12N2O6
- Molecular Weight: 244.2
- InChI Key: DRTQHJPVMGBUCF-UHFFFAOYSA-N
- InChI: InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 220-222ºC |
|---|---|
| CAS: | 3083-77-0 |
| MF: | C9H12N2O6 |
| Flash_Point: | N/A |
| Product_Name: | 1-β-D-Arabinofuranosyluracil |
| Density: | 1.7±0.1 g/cm3 |
| FW: | 244.201 |
| Bolling_Point: | N/A |
| Melting_Point: | 220-222ºC |
|---|---|
| Refractive_Index: | 1.643 |
| MF: | C9H12N2O6 |
| Exact_Mass: | 244.069534 |
| LogP: | -1.61 |
| FW: | 244.201 |
| Density: | 1.7±0.1 g/cm3 |
| PSA: | 124.78000 |
| Risk_Statements(EU): | R36/37/38 |
|---|---|
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| RTECS: | YQ8818000 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| Safety_Statements: | 22-24/25-36-26 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)