2-Bromo-5-hydroxy-4-methoxybenzaldehyde
Catalog No: FT-0601404
CAS No: 2973-59-3
- Molecular Formula: 231.04
- Formula Weight: C8H7BrO3
- Inchl Key: AHYSXUDLJOFNAB-UHFFFAOYSA-N
- Inchl: InChI=1S/C8H7BrO3/c1-12-8-3-6(9)5(4-10)2-7(8)11/h2-4,11H,1H3
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 231.043 |
| Density: | 1.7±0.1 g/cm3 |
| CAS: | 2973-59-3 |
| Bolling_Point: | 320.8±37.0 °C at 760 mmHg |
| Product_Name: | 2-Bromoisovanillin |
| Melting_Point: | 98-100ºC |
| Flash_Point: | 147.8±26.5 °C |
| MF: | C8H7BrO3 |
| Density: | 1.7±0.1 g/cm3 |
|---|---|
| LogP: | 2.27 |
| Flash_Point: | 147.8±26.5 °C |
| Melting_Point: | 98-100ºC |
| FW: | 231.043 |
| PSA: | 46.53000 |
| Exact_Mass: | 229.957855 |
| MF: | C8H7BrO3 |
| Bolling_Point: | 320.8±37.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Refractive_Index: | 1.623 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi: Irritant; |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | S26-S37/39 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2913000090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)