![6-BROMO-4H-IMIDAZO[4,5-B]PYRIDINE (CAS: 28279-49-4) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0647666.png "6-BROMO-4H-IMIDAZO[4,5-B]PYRIDINE chemical structure")
6-BROMO-4H-IMIDAZO[4,5-B]PYRIDINE
Catalog No: FT-0647666
CAS No: 28279-49-4
- Chemical Name: 6-BROMO-4H-IMIDAZO[4,5-B]PYRIDINE
- Molecular Formula: C6H4BrN3
- Molecular Weight: 198.02
- InChI Key: XPHWCAKVRKUXLK-UHFFFAOYSA-N
- InChI: InChI=1S/C6H4BrN3/c7-4-1-5-6(8-2-4)10-3-9-5/h1-3H,(H,8,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 415.7±25.0 °C at 760 mmHg |
|---|---|
| Symbol: | GHS07 |
| MF: | C6H4BrN3 |
| Melting_Point: | N/A |
| Flash_Point: | 205.2±23.2 °C |
| FW: | 198.020 |
| Product_Name: | 6-Bromo-4H-imidazo[4,5-b]pyridine |
| CAS: | 28279-49-4 |
| Density: | 1.9±0.1 g/cm3 |
| Refractive_Index: | 1.746 |
|---|---|
| PSA: | 41.57000 |
| Flash_Point: | 205.2±23.2 °C |
| FW: | 198.020 |
| LogP: | 1.39 |
| Exact_Mass: | 196.958847 |
| MF: | C6H4BrN3 |
| Bolling_Point: | 415.7±25.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| Density: | 1.9±0.1 g/cm3 |
| Safety_Statements: | H302-H315-H319-H335 |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Symbol: | GHS07 |
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
