3-Amino-1,2,4-benzotriazine 1,4-Dioxide
Catalog No: FT-0661586
CAS No: 27314-97-2
- Chemical Name: 3-Amino-1,2,4-benzotriazine 1,4-Dioxide
- Molecular Formula: C7H6N4O2
- Molecular Weight: 178.15
- InChI Key: ORYDPOVDJJZGHQ-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6N4O2/c8-7-9-11(13)6-4-2-1-3-5(6)10(7)12/h1-4H,(H2,8,9)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 493.6±28.0 °C at 760 mmHg |
|---|---|
| Symbol: | GHS07 |
| MF: | C7H6N4O2 |
| Melting_Point: | 220ºC |
| Flash_Point: | 252.3±24.0 °C |
| FW: | 178.148 |
| Product_Name: | Tirapazamine |
| CAS: | 27314-97-2 |
| Density: | 1.7±0.1 g/cm3 |
| PSA: | 89.83000 |
|---|---|
| Bolling_Point: | 493.6±28.0 °C at 760 mmHg |
| LogP: | -0.31 |
| MF: | C7H6N4O2 |
| Melting_Point: | 220ºC |
| Refractive_Index: | 1.777 |
| Flash_Point: | 252.3±24.0 °C |
| FW: | 178.148 |
| Exact_Mass: | 178.049072 |
| Vapor_Pressure: | 0.0±1.3 mmHg at 25°C |
| Density: | 1.7±0.1 g/cm3 |
| Safety_Statements: | 26-36 |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Hazard_Codes: | Xi: Irritant; |
| Symbol: | GHS07 |
| RTECS: | DM0671500 |
| Risk_Statements(EU): | 36/37/38 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)