glutaramic acid
Catalog No: FT-0657321
CAS No: 25335-74-4
- Chemical Name: glutaramic acid
- Molecular Formula: C5H9NO3
- Molecular Weight: 131.13
- InChI Key: GTFMAONWNTUZEW-UHFFFAOYSA-N
- InChI: InChI=1S/C5H9NO3/c6-4(7)2-1-3-5(8)9/h1-3H2,(H2,6,7)(H,8,9)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| Flash_Point: | 208.7ºC |
| Density: | 1.231g/cm3 |
| FW: | 131.13000 |
| Bolling_Point: | 421.5ºC at 760mmHg |
| MF: | C5H9NO3 |
| Product_Name: | glutaramic acid |
| CAS: | 25335-74-4 |
| Melting_Point: | N/A |
| Refractive_Index: | 1.481 |
|---|---|
| FW: | 131.13000 |
| LogP: | 0.42690 |
| Bolling_Point: | 421.5ºC at 760mmHg |
| MF: | C5H9NO3 |
| Flash_Point: | 208.7ºC |
| Vapor_Pressure: | 2.75E-08mmHg at 25°C |
| PSA: | 80.39000 |
| Density: | 1.231g/cm3 |
| Exact_Mass: | 131.05800 |
| Warning_Statement: | P305 + P351 + P338 |
|---|---|
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2924199090 |
| Safety_Statements: | H319 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)