8-GINGEROL
Catalog No: FT-0626693
CAS No: 23513-08-8
- Chemical Name: 8-GINGEROL
- Molecular Formula: C19H30O4
- Molecular Weight: 322.4
- InChI Key: BCIWKKMTBRYQJU-INIZCTEOSA-N
- InChI: InChI=1S/C19H30O4/c1-3-4-5-6-7-8-16(20)14-17(21)11-9-15-10-12-18(22)19(13-15)23-2/h10,12-13,16,20,22H,3-9,11,14H2,1-2H3/t16-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | [8]-Gingerol |
|---|---|
| Bolling_Point: | 476.4±35.0 °C at 760 mmHg |
| MF: | C19H30O4 |
| Symbol: | GHS07 |
| Melting_Point: | 30 - 32 °C |
| CAS: | 23513-08-8 |
| Density: | 1.1±0.1 g/cm3 |
| FW: | 322.439 |
| Flash_Point: | 162.6±19.4 °C |
| MF: | C19H30O4 |
|---|---|
| Bolling_Point: | 476.4±35.0 °C at 760 mmHg |
| Exact_Mass: | 322.214417 |
| Melting_Point: | 30 - 32 °C |
| Refractive_Index: | 1.517 |
| PSA: | 66.76000 |
| Flash_Point: | 162.6±19.4 °C |
| Density: | 1.1±0.1 g/cm3 |
| FW: | 322.439 |
| LogP: | 3.55 |
| Vapor_Pressure: | 0.0±1.3 mmHg at 25°C |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| RTECS: | JR4362000 |
| Safety_Statements: | H317 |
| Warning_Statement: | P280 |
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)