L-2-Thienylalanine
Catalog No: FT-0600742
CAS No: 22951-96-8
- Chemical Name: L-2-Thienylalanine
- Molecular Formula: C7H9NO2S
- Molecular Weight: 171.22
- InChI Key: WTOFYLAWDLQMBZ-LURJTMIESA-N
- InChI: InChI=1S/C7H9NO2S/c8-6(7(9)10)4-5-2-1-3-11-5/h1-3,6H,4,8H2,(H,9,10)/t6-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 315.9±32.0 °C at 760 mmHg |
|---|---|
| Symbol: | GHS07 |
| MF: | C7H9NO2S |
| Melting_Point: | 255-263ºC |
| Flash_Point: | 144.9±25.1 °C |
| FW: | 171.217 |
| Product_Name: | 3-(2-Thienyl)-L-alanine |
| CAS: | 22951-96-8 |
| Density: | 1.3±0.1 g/cm3 |
| PSA: | 91.56000 |
|---|---|
| Refractive_Index: | 1.608 |
| Flash_Point: | 144.9±25.1 °C |
| FW: | 171.217 |
| LogP: | 0.79 |
| Exact_Mass: | 171.035400 |
| Bolling_Point: | 315.9±32.0 °C at 760 mmHg |
| MF: | C7H9NO2S |
| Melting_Point: | 255-263ºC |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Density: | 1.3±0.1 g/cm3 |
| Safety_Statements: | S26-S36 |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Hazard_Codes: | Xi: Irritant; |
| Symbol: | GHS07 |
| HS_Code: | 2934999090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Risk_Statements(EU): | R36/37/38 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)