N-ACETYLINDOLE-3-CARBOXALDEHYDE
Catalog No: FT-0607280
CAS No: 22948-94-3
- Molecular Formula: 187.19
- Formula Weight: C11H9NO2
- Inchl Key: LCJLFGSKHBDOAY-UHFFFAOYSA-N
- Inchl: InChI=1S/C11H9NO2/c1-8(14)12-6-9(7-13)10-4-2-3-5-11(10)12/h2-7H,1H3
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 187.195 |
|---|---|
| CAS: | 22948-94-3 |
| Flash_Point: | 157.0±20.4 °C |
| MF: | C11H9NO2 |
| Symbol: | Warning |
| Bolling_Point: | 336.0±15.0 °C at 760 mmHg |
| Melting_Point: | 165 °C(lit.) |
| Product_Name: | 1-Acetylindole-3-carboxaldehyde |
| Density: | 1.2±0.1 g/cm3 |
| FW: | 187.195 |
|---|---|
| MF: | C11H9NO2 |
| Refractive_Index: | 1.598 |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Bolling_Point: | 336.0±15.0 °C at 760 mmHg |
| Exact_Mass: | 187.063324 |
| PSA: | 39.07000 |
| Computational_Chemistry: | ['1. XlogP :13 ', '2. Hydrogen Bond Donor Count 0 ', '3. Hydrogen Bond Acceptor Count 2 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count ', '6. TPSA :391 ', '7. Heavy Atom Count 14 ', '8. Topological Polar Surface Area 0 ', '9. Complexity 252 ', '10. Isotope Atom Count 0 ', '11. Defined Atom Stereocenter Count 0 ', '12. Undefined Atom Stereocenter Count 0 ', '13. Defined Bond Stereocenter Count 0 ', '14. Undefined Bond Stereocenter Count 0 ', '15. Covalently-Bonded Unit Count 1'] |
| Molecular_Structure: | ['五分子性质数据 ', '1 . Molar refractive index 5361 ', '2 . Molar volume 1571 ', '3 . Parachor (902K)4074 ', '4 表面张力(dyne/cm)452 ', '5 . Polarizability (10-24cm3)2125'] |
| LogP: | 1.60 |
| Melting_Point: | 165 °C(lit.) |
| Flash_Point: | 157.0±20.4 °C |
| Density: | 1.2±0.1 g/cm3 |
| More_Info: | ['1. Appearance Unknow ', '2. Density（g/mL,25/4℃）Unknow ', '3. Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4. Melting point（ºC）165 ', '5. Boiling point（ºC,Atmospheric pressure）Unknow ', '6. Boiling point（ºC,52kPa）Unknow ', '7. Refractive indexUnknow ', '8. Flash point（ºC）Unknow ', '9. Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Unknow'] |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Symbol: | GHS07 |
| WGK_Germany: | 3 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R36/37/38 |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2933990090 |
Related Products
(5E)-5-(3-Ethoxy-2-hydroxybenzylidene)-2-mercapto-1,3-thiazol-4(5H)-one
