2-Methoxyethyl acetoacetate
Catalog No: FT-0612839
CAS No: 22502-03-0
- Molecular Formula: 160.17
- Formula Weight: C7H12O4
- Inchl Key: PLHCSZRZWOWUBW-UHFFFAOYSA-N
- Inchl: InChI=1S/C7H12O4/c1-6(8)5-7(9)11-4-3-10-2/h3-5H2,1-2H3
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07, GHS08 |
|---|---|
| CAS: | 22502-03-0 |
| Flash_Point: | 103.3±0.0 °C |
| Product_Name: | 2-Methoxyethyl acetoacetate |
| Bolling_Point: | 228.8±15.0 °C at 760 mmHg |
| FW: | 160.168 |
| Melting_Point: | N/A |
| MF: | C7H12O4 |
| Density: | 1.1±0.1 g/cm3 |
| Refractive_Index: | 1.418 |
|---|---|
| Vapor_Pressure: | 0.1±0.5 mmHg at 25°C |
| Flash_Point: | 103.3±0.0 °C |
| LogP: | -0.07 |
| Bolling_Point: | 228.8±15.0 °C at 760 mmHg |
| PSA: | 52.60000 |
| Molecular_Structure: | ['1 . Molar refractive index 3802 ', '2 . Molar volume (cm3/mol)1510 ', '3 . Parachor (902K)3601 ', '4 表面张力(dyne/cm)323 ', '5 . Polarizability (10-24cm3)1507'] |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :4 ', '4. Rotatable Bond Count :6 ', '5. Isotope Atom Count :5 ', '6. TPSA 526 ', '7. Heavy Atom Count :11 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :141 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| MF: | C7H12O4 |
| Exact_Mass: | 160.073563 |
| FW: | 160.168 |
| Density: | 1.1±0.1 g/cm3 |
| More_Info: | ['1. Appearance Unknow ', '2. Density（g/mL,25/4℃）109 ', '3. Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4. Melting point（ºC）Unknow ', '5. Boiling point（ºC,Atmospheric pressure）120°C20mm Hg(lit) ', '6. Boiling point（ºC,52kPa）Unknow ', '7. Refractive index 1434 ', '8. Flash point（ºC） 218°F ', '9. Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Unknow'] |
| Symbol: | GHS07, GHS08 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2918300090 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi:Irritant; |
| Warning_Statement: | P201-P260-P280-P304 + P340 + P312-P308 + P311-P337 + P313 |
| Safety_Statements: | H315-H319-H335-H360FD-H371 |
