naphthalene-1,4-diamine
Catalog No: FT-0737124
CAS No: 2243-61-0
- Chemical Name: naphthalene-1,4-diamine
- Molecular Formula: C10H10N2
- Molecular Weight: 158.2
- InChI Key: OKBVMLGZPNDWJK-UHFFFAOYSA-N
- InChI: InChI=1S/C10H10N2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6H,11-12H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 158.200 |
|---|---|
| CAS: | 2243-61-0 |
| Flash_Point: | 211.5±21.8 °C |
| MF: | C10H10N2 |
| Symbol: | Warning |
| Bolling_Point: | 369.6±22.0 °C at 760 mmHg |
| Melting_Point: | 114-116ºC |
| Product_Name: | 1,4-Naphthalenediamine |
| Density: | 1.2±0.1 g/cm3 |
| FW: | 158.200 |
|---|---|
| MF: | C10H10N2 |
| Exact_Mass: | 158.084396 |
| Bolling_Point: | 369.6±22.0 °C at 760 mmHg |
| LogP: | 0.55 |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| PSA: | 52.04000 |
| Refractive_Index: | 1.757 |
| Melting_Point: | 114-116ºC |
| Flash_Point: | 211.5±21.8 °C |
| Density: | 1.2±0.1 g/cm3 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| RTECS: | QJ3380000 |
| Symbol: | GHS07 |
| Warning_Statement: | P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R22 |
| Hazard_Codes: | Xn: Harmful; |
| Safety_Statements: | H302-H319 |
| HS_Code: | 2921590090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)