4-(Difluoromethoxy)aniline
Catalog No: FT-0616744
CAS No: 22236-10-8
- Molecular Formula: 159.13
- Formula Weight: C7H7F2NO
- Inchl Key: NDEZTSHWEPQVBX-UHFFFAOYSA-N
- Inchl: InChI=1S/C7H7F2NO/c8-7(9)11-6-3-1-5(10)2-4-6/h1-4,7H,10H2
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 4-difluoromethoxyaniline |
|---|---|
| Bolling_Point: | 224.1±30.0 °C at 760 mmHg |
| MF: | C7H7F2NO |
| Symbol: | GHS06 |
| Melting_Point: | N/A |
| CAS: | 22236-10-8 |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 159.133 |
| Flash_Point: | 89.3±24.6 °C |
| MF: | C7H7F2NO |
|---|---|
| Bolling_Point: | 224.1±30.0 °C at 760 mmHg |
| Exact_Mass: | 159.049576 |
| More_Info: | ['1. Appearance Unknow ', '2. Density（g/mL,25/4℃）1283 ', '3. Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4. Melting point（ºC）Unknow ', '5. Boiling point（ºC,Atmospheric pressure）98-100 ', '6. Boiling point（ºC,52kPa）Unknow ', '7. Refractive index 1505 ', '8. Flash point（ºC）>110 ', '9. Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Unknow'] |
| PSA: | 35.25000 |
| Flash_Point: | 89.3±24.6 °C |
| Refractive_Index: | 1.502 |
| Density: | 1.3±0.1 g/cm3 |
| Molecular_Structure: | ['1 . Molar refractive index 3745 ', '2 . Molar volume (cm3/mol)1269 ', '3 . Parachor (902K)3061 ', '4 表面张力(dyne/cm)337 ', '5 . Polarizability (10-24cm3)1484'] |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :4 ', '4. Rotatable Bond Count :2 ', '5. Isotope Atom Count :N/A ', '6. TPSA 352 ', '7. Heavy Atom Count :11 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :113 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| FW: | 159.133 |
| LogP: | 0.92 |
| Vapor_Pressure: | 0.1±0.4 mmHg at 25°C |
| Risk_Statements(EU): | R22;R36/37/38;R43 |
|---|---|
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Safety_Statements: | H301-H315-H319-H335 |
| HS_Code: | 2922299090 |
| WGK_Germany: | 2 |
| Warning_Statement: | P261-P301 + P310-P305 + P351 + P338 |
| RIDADR: | UN 2811 6.1/PG 3 |
| Symbol: | GHS06 |
| Hazard_Codes: | Xn:Harmful; |
Related Products
(5E)-5-(3-Ethoxy-2-hydroxybenzylidene)-2-mercapto-1,3-thiazol-4(5H)-one
