1-Methylguanidine hydrochloride
Catalog No: FT-0608085
CAS No: 21770-81-0
- Chemical Name: 1-Methylguanidine hydrochloride
- Molecular Formula: C2H8ClN3
- Molecular Weight: 109.56
- InChI Key: VJQCNCOGZPSOQZ-UHFFFAOYSA-N
- InChI: InChI=1S/C2H7N3.ClH/c1-5-2(3)4;/h1H3,(H4,3,4,5);1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 109.55800 |
| Density: | 1.22 g/mL at 20 °C(lit.) |
| CAS: | 21770-81-0 |
| Bolling_Point: | 72 °C |
| Product_Name: | 2-methylguanidine,hydrochloride |
| Melting_Point: | -20 °C |
| Flash_Point: | 65 °F |
| MF: | C2H8ClN3 |
| Molecular_Structure: | |
|---|---|
| Flash_Point: | 65 °F |
| Refractive_Index: | n20/D 1.4279(lit.) |
| FW: | 109.55800 |
| Density: | 1.22 g/mL at 20 °C(lit.) |
| Bolling_Point: | 72 °C |
| Melting_Point: | -20 °C |
| Computational_Chemistry: | ['1. XlogP : ', '2. Hydrogen Bond Donor Count 3 ', '3. Hydrogen Bond Acceptor Count 3 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count 2 ', '6. TPSA :665 ', '7. Heavy Atom Count 6 ', '8. Topological Polar Surface Area 0 ', '9. Complexity 402 ', '10. Isotope Atom Count 0 ', '11. Defined Atom Stereocenter Count 0 ', '12. Undefined Atom Stereocenter Count 0 ', '13. Defined Bond Stereocenter Count 0 ', '14. Undefined Bond Stereocenter Count 0 ', '15. Covalently-Bonded Unit Count 2'] |
| LogP: | 1.09220 |
| Water_Solubility: | insoluble |
| PSA: | 61.90000 |
| MF: | C2H8ClN3 |
| More_Info: | ['1. Appearance Unknow ', '2. Density(g/mL,25/4℃)Unknow ', '3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)Unknow ', '5. Boiling point(ºC,Atmospheric pressure)Unknow ', '6. Boiling point(ºC,52kPa)Unknow ', '7. Refractive indexUnknow ', '8. Flash point(ºC)Unknow ', '9. Specific rotation(º)Unknow ', '10. Spontaneous ignition point or ignition temperature(ºC)Unknow ', '11. Vapor pressure(kPa,25ºC)Unknow ', '12. Saturated vapor pressure(kPa,60ºC)Unknow ', '13. Combustion heat(KJ/mol)Unknow ', '14. Critical temperature(ºC)Unknow ', '15. Critical pressure(KPa)Unknow ', '16. Oil-water(Octanol /Water )Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion(%,V/V)Unknow ', '18. Lower limit of explosion(%,V/V)Unknow ', '19. Solubility Unknow'] |
| Exact_Mass: | 109.04100 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| RTECS: | MF3990000 |
| Risk_Statements(EU): | R22 |
| Safety_Statements: | S26-S36/37 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn: Harmful; |
| Warning_Statement: | P280-P301 + P312 + P330-P305 + P351 + P338-P337 + P313 |
| WGK_Germany: | 3 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)