2'-O-Methylcytidine
Catalog No: FT-0649900
CAS No: 2140-72-9
- Chemical Name: 2'-O-Methylcytidine
- Molecular Formula: C10H15N3O5
- Molecular Weight: 257.24
- InChI Key: RFCQJGFZUQFYRF-ZOQUXTDFSA-N
- InChI: InChI=1S/C10H15N3O5/c1-17-8-7(15)5(4-14)18-9(8)13-3-2-6(11)12-10(13)16/h2-3,5,7-9,14-15H,4H2,1H3,(H2,11,12,16)/t5-,7-,8-,9-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 257.243 |
|---|---|
| CAS: | 2140-72-9 |
| Melting_Point: | 252-253ºC |
| Bolling_Point: | 506.0±60.0 °C at 760 mmHg |
| MF: | C10H15N3O5 |
| Product_Name: | 2′-O-methylcytidine |
| Flash_Point: | 259.8±32.9 °C |
| Density: | 1.7±0.1 g/cm3 |
| FW: | 257.243 |
|---|---|
| MF: | C10H15N3O5 |
| Exact_Mass: | 257.101166 |
| Flash_Point: | 259.8±32.9 °C |
| LogP: | -1.09 |
| PSA: | 119.83000 |
| Vapor_Pressure: | 0.0±3.0 mmHg at 25°C |
| Bolling_Point: | 506.0±60.0 °C at 760 mmHg |
| Melting_Point: | 252-253ºC |
| Density: | 1.7±0.1 g/cm3 |
| Refractive_Index: | 1.677 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| HS_Code: | 2934999090 |
| Safety_Statements: | 26-36 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R36/37/38 |
| Hazard_Codes: | Xi |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)