5-Amino-8-quinolinol dihydrochloride
Catalog No: FT-0638107
CAS No: 21302-43-2
- Chemical Name: 5-Amino-8-quinolinol dihydrochloride
- Molecular Formula: C9H10Cl2N2O
- Molecular Weight: 233.09
- InChI Key: VTQDJAUGGZFPOI-UHFFFAOYSA-N
- InChI: InChI=1S/C9H8N2O.2ClH/c10-7-3-4-8(12)9-6(7)2-1-5-11-9;;/h1-5,12H,10H2;2*1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 233.094 |
| Density: | 1.363g/cm3 |
| CAS: | 21302-43-2 |
| Bolling_Point: | 408.3ºC at 760mmHg |
| Product_Name: | 5-Amino-8-quinolinol dihydrochloride |
| Melting_Point: | 279 °C (dec.)(lit.) |
| Flash_Point: | 200.7ºC |
| MF: | C9H10Cl2N2O |
| Flash_Point: | 200.7ºC |
|---|---|
| FW: | 233.094 |
| Density: | 1.363g/cm3 |
| Bolling_Point: | 408.3ºC at 760mmHg |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :4 ', '3. Hydrogen Bond Acceptor Count :3 ', '4. Rotatable Bond Count :0 ', '5. Isotope Atom Count :12 ', '6. TPSA 591 ', '7. Heavy Atom Count :14 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :163 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :3'] |
| LogP: | 3.70780 |
| Melting_Point: | 279 °C (dec.)(lit.) |
| PSA: | 59.14000 |
| MF: | C9H10Cl2N2O |
| More_Info: | ['1. Appearance Unknow ', '2. Density(g/mL,25/4℃)Unknow ', '3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)279 ', '5. Boiling point(ºC,Atmospheric pressure)Unknow ', '6. Boiling point(ºC,52kPa)Unknow ', '7. Refractive indexUnknow ', '8. Flash point(ºC)Unknow ', '9. Specific rotation(º)Unknow ', '10. Spontaneous ignition point or ignition temperature(ºC)Unknow ', '11. Vapor pressure(kPa,25ºC)Unknow ', '12. Saturated vapor pressure(kPa,60ºC)Unknow ', '13. Combustion heat(KJ/mol)Unknow ', '14. Critical temperature(ºC)Unknow ', '15. Critical pressure(KPa)Unknow ', '16. Oil-water(Octanol /Water )Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion(%,V/V)Unknow ', '18. Lower limit of explosion(%,V/V)Unknow ', '19. Solubility Unknow'] |
| Vapor_Pressure: | 1.9E-08mmHg at 25°C |
| Exact_Mass: | 232.017014 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi:Irritant; |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | S26-S37/39 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 29334990 |
| WGK_Germany: | 3 |
Related Products
4,5-DIHYDRO-2[6-AMINO-2-BENZTHIAZOLYL]-4-THIAZOLE CARBOXYLIC ACID
2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]acetic acid
tert-butyl 4-quinolin-3-yl-3,6-dihydro-2H-pyridine-1-carboxylate