4-Methyl-2-(2-thienyl)-1,3-thiazole-5-carboxylic acid
Catalog No: FT-0680279
CAS No: 209540-08-9
- Chemical Name: 4-Methyl-2-(2-thienyl)-1,3-thiazole-5-carboxylic acid
- Molecular Formula: C9H7NO2S2
- Molecular Weight: 225.3
- InChI Key: DSMGYNWKEJBPKW-UHFFFAOYSA-N
- InChI: InChI=1S/C9H7NO2S2/c1-5-7(9(11)12)14-8(10-5)6-3-2-4-13-6/h2-4H,1H3,(H,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 225.28700 |
| Density: | N/A |
| CAS: | 209540-08-9 |
| Bolling_Point: | N/A |
| Product_Name: | 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylic acid |
| Melting_Point: | 233-235ºC |
| Flash_Point: | N/A |
| MF: | C9H7NO2S2 |
| LogP: | 2.87820 |
|---|---|
| Melting_Point: | 233-235ºC |
| FW: | 225.28700 |
| PSA: | 106.67000 |
| MF: | C9H7NO2S2 |
| Exact_Mass: | 224.99200 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)