6-(2-Thienyl)-2-pyridinecarbaldehyde
Catalog No: FT-0692825
CAS No: 208111-00-6
- Chemical Name: 6-(2-Thienyl)-2-pyridinecarbaldehyde
- Molecular Formula: C10H7NOS
- Molecular Weight: 189.24
- InChI Key: HZFJKPQZABOKLA-UHFFFAOYSA-N
- InChI: InChI=1S/C10H7NOS/c12-7-8-3-1-4-9(11-8)10-5-2-6-13-10/h1-7H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 189.23400 |
| Density: | 1.269g/cm3 |
| CAS: | 208111-00-6 |
| Bolling_Point: | 324.663ºC at 760 mmHg |
| Product_Name: | 6-thiophen-2-ylpyridine-2-carbaldehyde |
| Melting_Point: | 57-61ºC |
| Flash_Point: | 150.151ºC |
| MF: | C10H7NOS |
| Density: | 1.269g/cm3 |
|---|---|
| LogP: | 2.62260 |
| Flash_Point: | 150.151ºC |
| Melting_Point: | 57-61ºC |
| FW: | 189.23400 |
| PSA: | 58.20000 |
| Exact_Mass: | 189.02500 |
| MF: | C10H7NOS |
| Bolling_Point: | 324.663ºC at 760 mmHg |
| Vapor_Pressure: | 0mmHg at 25°C |
| Refractive_Index: | 1.645 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xn |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H318-H335 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)