 
                                         
                                        (S)-Styrene oxide
Catalog No: FT-0605345
CAS No: 20780-54-5
- Chemical Name: (S)-Styrene oxide
- Molecular Formula: C8H8O
- Molecular Weight: 120.15
- InChI Key: AWMVMTVKBNGEAK-MRVPVSSYSA-N
- InChI: InChI=1S/C8H8O/c1-2-4-7(5-3-1)8-6-9-8/h1-5,8H,6H2/t8-/m1/s1
| Assay | Pack Size | Price | Stock | Action | 
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A | 
| Symbol: | GHS06, GHS08 | 
|---|---|
| CAS: | 20780-54-5 | 
| Flash_Point: | 79.4±0.0 °C | 
| Product_Name: | (S)-Styrene oxide | 
| Bolling_Point: | 193.9±9.0 °C at 760 mmHg | 
| FW: | 120.148 | 
| Melting_Point: | N/A | 
| MF: | C8H8O | 
| Density: | 1.1±0.1 g/cm3 | 
| Refractive_Index: | 1.564 | 
|---|---|
| Vapor_Pressure: | 0.6±0.4 mmHg at 25°C | 
| Flash_Point: | 79.4±0.0 °C | 
| LogP: | 1.61 | 
| Bolling_Point: | 193.9±9.0 °C at 760 mmHg | 
| PSA: | 12.53000 | 
| Molecular_Structure: | ['1 . Molar refractive index 3527 ', '2 . Molar volume (cm3/mol)1084 ', '3 . Parachor (902K)2780 ', '4 表面张力(dyne/cm)432 ', '5 . Polarizability (10-24cm3)1398'] | 
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :1 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count :N/A ', '6. TPSA 125 ', '7. Heavy Atom Count :9 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :947 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :1 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] | 
| MF: | C8H8O | 
| Exact_Mass: | 120.057518 | 
| FW: | 120.148 | 
| Density: | 1.1±0.1 g/cm3 | 
| More_Info: | ['1. Appearance Unknow ', '2. Density(g/mL,25/4℃)1051 ', '3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)Unknow ', '5. Boiling point(ºC,Atmospheric pressure)192-194 ', '6. Boiling point(ºC,52kPa)Unknow ', '7. Refractive index1535 ', '8. Flash point(ºC)175 ', '9. Specific rotation(º)-33º(neat) ', '10. Spontaneous ignition point or ignition temperature(ºC)Unknow ', '11. Vapor pressure(kPa,25ºC)Unknow ', '12. Saturated vapor pressure(kPa,60ºC)Unknow ', '13. Combustion heat(KJ/mol)Unknow ', '14. Critical temperature(ºC)Unknow ', '15. Critical pressure(KPa)Unknow ', '16. Oil-water(Octanol /Water )Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion(%,V/V)Unknow ', '18. Lower limit of explosion(%,V/V)Unknow ', '19. Solubility Unknow'] | 
| Symbol: | GHS06, GHS08 | 
|---|---|
| RIDADR: | UN 2810 6.1/PG 3 | 
| HS_Code: | 2910900090 | 
| Risk_Statements(EU): | R45;R20/21;R36/38 | 
| WGK_Germany: | 3 | 
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter | 
| RTECS: | CZ9625030 | 
| Hazard_Codes: | T:Toxic; | 
| Warning_Statement: | P201-P261-P280-P305 + P351 + P338-P311 | 
| Safety_Statements: | H311-H315-H319-H331-H350 | 
 
                             
                                                     
                                                     
                                                     
                                                     
                                                     
                                                     
                                                     
                                                     
                                                    