(R)-Styrene oxide
Catalog No: FT-0605077
CAS No: 20780-53-4
- Molecular Formula: 120.15
- Formula Weight: C8H8O
- Inchl Key: AWMVMTVKBNGEAK-QMMMGPOBSA-N
- Inchl: InChI=1S/C8H8O/c1-2-4-7(5-3-1)8-6-9-8/h1-5,8H,6H2/t8-/m0/s1
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07, GHS08 |
|---|---|
| CAS: | 20780-53-4 |
| Flash_Point: | 79.4±0.0 °C |
| Product_Name: | (S)-Styrene oxide |
| Bolling_Point: | 193.9±9.0 °C at 760 mmHg |
| FW: | 120.148 |
| Melting_Point: | -37ºC |
| MF: | C8H8O |
| Density: | 1.1±0.1 g/cm3 |
| Refractive_Index: | 1.564 |
|---|---|
| Vapor_Pressure: | 0.6±0.4 mmHg at 25°C |
| Flash_Point: | 79.4±0.0 °C |
| LogP: | 1.61 |
| Bolling_Point: | 193.9±9.0 °C at 760 mmHg |
| PSA: | 12.53000 |
| Molecular_Structure: | ['1 . Molar refractive index 3527 ', '2 . Molar volume (cm3/mol)1084 ', '3 . Parachor (902K)2780 ', '4 表面张力(dyne/cm)432 ', '5 . Polarizability (10-24cm3)1398'] |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :1 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count :N/A ', '6. TPSA 125 ', '7. Heavy Atom Count :9 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :947 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :1 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | -37ºC |
| MF: | C8H8O |
| Exact_Mass: | 120.057518 |
| FW: | 120.148 |
| Density: | 1.1±0.1 g/cm3 |
| More_Info: | ['1. Appearance Liquid ', '2. Density（g/mL,25/4℃）10523 ', '3相对. Density（20℃，4℃）1052316 ', '4. Melting point（ºC）-356 ', '5. Boiling point（ºC,Atmospheric pressure）1941 ', '6. Boiling point（ºC,52kPa）Unknow ', '7常温. Refractive index(n20D)15342 ', '8. Flash point（ºC）Unknow ', '9. Specific rotation（º）-21º(c=5,chloroform23ºC) ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Soluble in Ethanol Ethyl ether and 苯。'] |
| Symbol: | GHS07, GHS08 |
|---|---|
| RIDADR: | UN 2810 |
| HS_Code: | 2910900090 |
| Packing_Group: | III |
| Hazard_Class: | 6.1 |
| Risk_Statements(EU): | R21;R36;R45 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| RTECS: | CZ9625010 |
| Hazard_Codes: | T:Toxic; |
| Warning_Statement: | P201-P280-P305 + P351 + P338-P308 + P313 |
| Safety_Statements: | H312-H319-H350 |
Related Products
(5E)-5-(3-Ethoxy-2-hydroxybenzylidene)-2-mercapto-1,3-thiazol-4(5H)-one
