2,6-Dichlorobenzyl bromide
Catalog No: FT-0610602
CAS No: 20443-98-5
- Molecular Formula: 239.92
- Formula Weight: C7H5BrCl2
- Inchl Key: PDFGFQUSSYSWNI-UHFFFAOYSA-N
- Inchl: InChI=1S/C7H5BrCl2/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 20443-98-5 |
| Flash_Point: | 126.2±13.3 °C |
| Product_Name: | 2,6-Dichlorobenzyl bromide |
| Bolling_Point: | 260.9±25.0 °C at 760 mmHg |
| FW: | 239.925 |
| Melting_Point: | 54-56 °C(lit.) |
| MF: | C7H5BrCl2 |
| Density: | 1.7±0.1 g/cm3 |
| Refractive_Index: | 1.597 |
|---|---|
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Flash_Point: | 126.2±13.3 °C |
| LogP: | 4.12 |
| Bolling_Point: | 260.9±25.0 °C at 760 mmHg |
| More_Info: | ['1. Appearance White 晶体状粉末 ', '2. Density（g/mL,25/4℃）Unknow ', '3. Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4. Melting point（ºC）55-57 ', '5. Boiling point（ºC,Atmospheric pressure）>110 ', '6. Boiling point（ºC,52kPa）Unknow ', '7. Refractive indexUnknow ', '8. Flash point（ºC）>230 ', '9. Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Unknow'] |
| Molecular_Structure: | ['1 . Molar refractive index 4869 ', '2 . Molar volume (cm3/mol)1428 ', '3 . Parachor (902K)3679 ', '4 表面张力(dyne/cm)440 ', '5 . Polarizability (10-24cm3)1930'] |
| Computational_Chemistry: | ['1. XlogP :37 ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :0 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count :N/A ', '6. TPSA 0 ', '7. Heavy Atom Count :10 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :978 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 54-56 °C(lit.) |
| MF: | C7H5BrCl2 |
| Exact_Mass: | 237.895157 |
| FW: | 239.925 |
| Density: | 1.7±0.1 g/cm3 |
| Symbol: | GHS05, GHS07 |
|---|---|
| RIDADR: | UN 3261 8/PG 2 |
| HS_Code: | 2903999090 |
| Packing_Group: | II |
| Hazard_Class: | 8 |
| Risk_Statements(EU): | R34 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| RTECS: | XS7966000 |
| Hazard_Codes: | C:Corrosive; |
| Warning_Statement: | P261-P280-P305 + P351 + P338-P310 |
| Safety_Statements: | H314-H335 |
Related Products
(5E)-5-(3-Ethoxy-2-hydroxybenzylidene)-2-mercapto-1,3-thiazol-4(5H)-one
