Ginkgolic acid (13:0)
Catalog No: FT-0697966
CAS No: 20261-38-5
- Chemical Name: Ginkgolic acid (13:0)
- Molecular Formula: C20H32O3
- Molecular Weight: 320.5
- InChI Key: VEPUCZUJLKAVNM-UHFFFAOYSA-N
- InChI: InChI=1S/C20H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-14-17-15-13-16-18(21)19(17)20(22)23/h13,15-16,21H,2-12,14H2,1H3,(H,22,23)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 20261-38-5 |
| Flash_Point: | 239.8±21.9 °C |
| Product_Name: | Ginkgolic Acid (C13:0) |
| Bolling_Point: | 449.5±33.0 °C at 760 mmHg |
| FW: | 320.466 |
| Melting_Point: | N/A |
| MF: | C20H32O3 |
| Density: | 1.0±0.1 g/cm3 |
| Refractive_Index: | 1.519 |
|---|---|
| Vapor_Pressure: | 0.0±1.2 mmHg at 25°C |
| MF: | C20H32O3 |
| Flash_Point: | 239.8±21.9 °C |
| LogP: | 8.90 |
| FW: | 320.466 |
| Density: | 1.0±0.1 g/cm3 |
| PSA: | 57.53000 |
| Bolling_Point: | 449.5±33.0 °C at 760 mmHg |
| Exact_Mass: | 320.235138 |
| Symbol: | GHS07 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)