(S)-(-)-1,2-Diaminopropane dihydrochloride
Catalog No: FT-0605293
CAS No: 19777-66-3
- Chemical Name: (S)-(-)-1,2-Diaminopropane dihydrochloride
- Molecular Formula: C3H12Cl2N2
- Molecular Weight: 147.04 g/mol
- InChI Key: AEIAMRMQKCPGJR-QTNFYWBSSA-N
- InChI: InChI=1S/C3H10N2.2ClH/c1-3(5)2-4;;/h3H,2,4-5H2,1H3;2*1H/t3-;;/m0../s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 147.047 |
| Density: | N/A |
| CAS: | 19777-66-3 |
| Bolling_Point: | 215.8ºC at 760 mmHg |
| Product_Name: | (S)-(-)-1,2-Diaminopropane dihydrochloride |
| Melting_Point: | 227-229ºC |
| Flash_Point: | 84.3ºC |
| MF: | C3H12Cl2N2 |
| LogP: | 2.29690 |
|---|---|
| Flash_Point: | 84.3ºC |
| FW: | 147.047 |
| Bolling_Point: | 215.8ºC at 760 mmHg |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :4 ', '3. Hydrogen Bond Acceptor Count :2 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count :N/A ', '6. TPSA 52 ', '7. Heavy Atom Count :7 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :209 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :1 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :3'] |
| Melting_Point: | 227-229ºC |
| PSA: | 52.04000 |
| MF: | C3H12Cl2N2 |
| More_Info: | ['1. Appearance Unknow ', '2. Density(g/mL,25/4℃)Unknow ', '3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)238-243 ', '5. Boiling point(ºC,Atmospheric pressure)Unknow ', '6. Boiling point(ºC,52kPa)Unknow ', '7. Refractive indexUnknow ', '8. Flash point(ºC)Unknow ', '9. Specific rotation(º -4 º (c=20 in H2O) ', '10. Spontaneous ignition point or ignition temperature(ºC)Unknow ', '11. Vapor pressure(kPa,25ºC)Unknow ', '12. Saturated vapor pressure(kPa,60ºC)Unknow ', '13. Combustion heat(KJ/mol)Unknow ', '14. Critical temperature(ºC)Unknow ', '15. Critical pressure(KPa)Unknow ', '16. Oil-water(Octanol /Water )Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion(%,V/V)Unknow ', '18. Lower limit of explosion(%,V/V)Unknow ', '19. Solubility Unknow'] |
| Vapor_Pressure: | 0.12mmHg at 25°C |
| Exact_Mass: | 146.037750 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi:Irritant; |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | S26-S36 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2921290000 |
| WGK_Germany: | 3 |
Related Products
2-(2-quinolin-3-ylpyridin-4-yl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one
6-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole