![N-[1-(Aminomethyl)propyl]-N,N-dimethylamine (CAS: 19764-59-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0678993.png "N-[1-(Aminomethyl)propyl]-N,N-dimethylamine chemical structure")
N-[1-(Aminomethyl)propyl]-N,N-dimethylamine
Catalog No: FT-0678993
CAS No: 19764-59-1
- Chemical Name: N-[1-(Aminomethyl)propyl]-N,N-dimethylamine
- Molecular Formula: C6H16N2
- Molecular Weight: 116.20
- InChI Key: QYMUENUCKRLOTB-UHFFFAOYSA-N
- InChI: InChI=1S/C6H16N2/c1-4-6(5-7)8(2)3/h6H,4-5,7H2,1-3H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 116.20500 |
| Density: | 0.836g/cm3 |
| CAS: | 19764-59-1 |
| Bolling_Point: | 128.2ºC at 760 mmHg |
| Product_Name: | 2-N,2-N-dimethylbutane-1,2-diamine |
| Melting_Point: | N/A |
| Flash_Point: | 27.8ºC |
| MF: | C6H16N2 |
| Density: | 0.836g/cm3 |
|---|---|
| LogP: | 0.98560 |
| Flash_Point: | 27.8ºC |
| Refractive_Index: | 1.446 |
| FW: | 116.20500 |
| PSA: | 29.26000 |
| MF: | C6H16N2 |
| Bolling_Point: | 128.2ºC at 760 mmHg |
| Vapor_Pressure: | 10.8mmHg at 25°C |
| Exact_Mass: | 116.13100 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2921290000 |
| RIDADR: | NONH for all modes of transport |
Related Products
Acetamide, N-[(6R)-6-amino-4,5,6,7-tetrahydro-2-benzothiazolyl]-
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-