Ciproxifan Maleate
Catalog No: FT-0697872
CAS No: 184025-19-2
- Chemical Name: Ciproxifan Maleate
- Molecular Formula: C20H22N2O6
- Molecular Weight: 386.4
- InChI Key: RLQFKEYRALXXEJ-BTJKTKAUSA-N
- InChI: InChI=1S/C16H18N2O2.C4H4O4/c19-16(12-3-4-12)13-5-7-15(8-6-13)20-9-1-2-14-10-17-11-18-14;5-3(6)1-2-4(7)8/h5-8,10-12H,1-4,9H2,(H,17,18);1-2H,(H,5,6)(H,7,8)/b;2-1-
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 386.398 |
| Density: | N/A |
| CAS: | 184025-19-2 |
| Bolling_Point: | 743.6ºC at 760 mmHg |
| Product_Name: | Ciproxifan |
| Melting_Point: | N/A |
| Flash_Point: | 403.5ºC |
| MF: | C20H22N2O6 |
| LogP: | 2.72580 |
|---|---|
| Flash_Point: | 403.5ºC |
| FW: | 386.398 |
| PSA: | 129.58000 |
| MF: | C20H22N2O6 |
| Bolling_Point: | 743.6ºC at 760 mmHg |
| Vapor_Pressure: | 3.22E-23mmHg at 25°C |
| Exact_Mass: | 386.147797 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R22 |
| Safety_Statements: | S26 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
Related Products
4-N-(9-ethylcarbazol-3-yl)-2-N-(3-morpholin-4-ylpropyl)pyrimidine-2,4-diamine
ethyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methylpyridine-3-carboxylate
1,2-Benzenedicarboxylic acid, di-C7-11-branched and linear Alkyl Esters