![5-METHOXY-1H-PYRROLO[2,3-B]PYRIDINE (CAS: 183208-36-8) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0648000.png "5-METHOXY-1H-PYRROLO[2,3-B]PYRIDINE chemical structure")
5-METHOXY-1H-PYRROLO[2,3-B]PYRIDINE
Catalog No: FT-0648000
CAS No: 183208-36-8
- Chemical Name: 5-METHOXY-1H-PYRROLO[2,3-B]PYRIDINE
- Molecular Formula: C8H8N2O
- Molecular Weight: 148.16
- InChI Key: AFUFCCUQHGSNAN-UHFFFAOYSA-N
- InChI: InChI=1S/C8H8N2O/c1-11-7-4-6-2-3-9-8(6)10-5-7/h2-5H,1H3,(H,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 148.162 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 183208-36-8 |
| Bolling_Point: | 314.9±22.0 °C at 760 mmHg |
| Product_Name: | 5-Methoxy-1H-pyrrolo[2,3-b]pyridin |
| Melting_Point: | N/A |
| Flash_Point: | 107.9±12.0 °C |
| MF: | C8H8N2O |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 2.17 |
| Flash_Point: | 107.9±12.0 °C |
| Refractive_Index: | 1.647 |
| FW: | 148.162 |
| PSA: | 37.91000 |
| MF: | C8H8N2O |
| Bolling_Point: | 314.9±22.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 148.063660 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2-fluorophenyl)butanoic acid
