2-Bromo-1,3-dimethoxybenzene
Catalog No: FT-0689833
CAS No: 16932-45-9
- Chemical Name: 2-Bromo-1,3-dimethoxybenzene
- Molecular Formula: C8H9BrO2
- Molecular Weight: 217.06
- InChI Key: VHVYSMMZHORFKU-UHFFFAOYSA-N
- InChI: InChI=1S/C8H9BrO2/c1-10-6-4-3-5-7(11-2)8(6)9/h3-5H,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 217.060 |
| Density: | 1.412 |
| CAS: | 16932-45-9 |
| Bolling_Point: | 250 ºC |
| Product_Name: | 1-Bromo-2,6-dimethoxybenzene |
| Melting_Point: | 91-94ºC |
| Flash_Point: | 106 ºC |
| MF: | C8H9BrO2 |
| Density: | 1.412 |
|---|---|
| LogP: | 2.30 |
| Flash_Point: | 106 ºC |
| Melting_Point: | 91-94ºC |
| FW: | 217.060 |
| PSA: | 18.46000 |
| Exact_Mass: | 215.978592 |
| MF: | C8H9BrO2 |
| Bolling_Point: | 250 ºC |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Refractive_Index: | 1.528 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2909309090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)