1H-Indole-5-carboxamide
Catalog No: FT-0670336
CAS No: 1670-87-7
- Chemical Name: 1H-Indole-5-carboxamide
- Molecular Formula: C9H8N2O
- Molecular Weight: 160.17
- InChI Key: GQMYQEAXTITUAE-UHFFFAOYSA-N
- InChI: InChI=1S/C9H8N2O/c10-9(12)7-1-2-8-6(5-7)3-4-11-8/h1-5,11H,(H2,10,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 160.173 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 1670-87-7 |
| Bolling_Point: | 457.6±18.0 °C at 760 mmHg |
| Product_Name: | Indole-5-carboxamide |
| Melting_Point: | 159-163ºC |
| Flash_Point: | 230.6±21.2 °C |
| MF: | C9H8N2O |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 0.88 |
| Flash_Point: | 230.6±21.2 °C |
| Melting_Point: | 159-163ºC |
| FW: | 160.173 |
| PSA: | 58.88000 |
| Exact_Mass: | 160.063660 |
| MF: | C9H8N2O |
| Bolling_Point: | 457.6±18.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| Refractive_Index: | 1.717 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R22;R36/37/38 |
| Safety_Statements: | S26 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)