Benzothiazole-2-carbaldehyde
Catalog No: FT-0651404
CAS No: 1629-78-3
- Chemical Name: Benzothiazole-2-carbaldehyde
- Molecular Formula: C9H7NOS
- Molecular Weight: 177.22
- InChI Key: GSTOPVGJHLPSBJ-UHFFFAOYSA-N
- InChI: InChI=1S/C9H7NOS/c1-6(11)9-10-7-4-2-3-5-8(7)12-9/h2-5H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 109ºC |
|---|---|
| CAS: | 1629-78-3 |
| MF: | C9H7NOS |
| Flash_Point: | 136.4ºC |
| Product_Name: | 1-(1,3-Benzothiazol-2-yl)ethanone |
| Density: | 1.286 g/cm3 |
| FW: | 177.22300 |
| Bolling_Point: | 301.9ºC at 760 mmHg |
| Refractive_Index: | 1.655 |
|---|---|
| Vapor_Pressure: | 0.00103mmHg at 25°C |
| Flash_Point: | 136.4ºC |
| LogP: | 2.49890 |
| Bolling_Point: | 301.9ºC at 760 mmHg |
| FW: | 177.22300 |
| PSA: | 58.20000 |
| Melting_Point: | 109ºC |
| MF: | C9H7NOS |
| Exact_Mass: | 177.02500 |
| Density: | 1.286 g/cm3 |
| Safety_Statements: | S26-S36/37 |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| HS_Code: | 2934999090 |
| Risk_Statements(EU): | R22;R36;R43 |
Related Products
methyl 3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate
Benzofuran,polymer with ethenylbenzene and (1-methylethenyl)benzene (9CI)
2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridin-3-ylacetic acid