Rasagiline mesylate
Catalog No: FT-0631191
CAS No: 161735-79-1
- Molecular Formula: 267.35
- Formula Weight: C13H17NO3S
- Inchl Key: JDBJJCWRXSVHOQ-UTONKHPSSA-N
- Inchl: InChI=1S/C12H13N.CH4O3S/c1-2-9-13-12-8-7-10-5-3-4-6-11(10)12;1-5(2,3)4/h1,3-6,12-13H,7-9H2;1H3,(H,2,3,4)/t12-;/m1./s1
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 305.5ºC at 760 mmHg |
|---|---|
| CAS: | 161735-79-1 |
| MF: | C13H17NO3S |
| Melting_Point: | 155-158°C |
| Symbol: | Warning |
| Density: | 1.05 g/cm3 |
| FW: | 267.344 |
| Product_Name: | Rasagiline mesylate |
| Flash_Point: | 146.8ºC |
| Bolling_Point: | 305.5ºC at 760 mmHg |
|---|---|
| LogP: | 2.87240 |
| Vapor_Pressure: | 0.000816mmHg at 25°C |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :2 ', '3. Hydrogen Bond Acceptor Count :4 ', '4. Rotatable Bond Count :2 ', '5. Isotope Atom Count :N/A ', '6. TPSA 748 ', '7. Heavy Atom Count :18 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :305 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :1 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :2'] |
| Melting_Point: | 155-158°C |
| Exact_Mass: | 267.092926 |
| MF: | C13H17NO3S |
| Density: | 1.05 g/cm3 |
| FW: | 267.344 |
| PSA: | 74.78000 |
| Flash_Point: | 146.8ºC |
| WGK_Germany: | 3 |
|---|---|
| Symbol: | Warning |
| HS_Code: | 2921499090 |
| Safety_Statements: | S26-S37/39 |
| Hazard_Codes: | Xi |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R36/37/38:Irritating to eyes, respiratory system and skin . |
