5-AMINO-4-CARBETHOXY-1-PHENYLPYRAZOLE
Catalog No: FT-0619965
CAS No: 16078-71-0
- Chemical Name: 5-AMINO-4-CARBETHOXY-1-PHENYLPYRAZOLE
- Molecular Formula: C12H13N3O2
- Molecular Weight: 231.25
- InChI Key: AYJIUOZKKTUKKD-UHFFFAOYSA-N
- InChI: InChI=1S/C12H13N3O2/c1-2-17-12(16)10-8-14-15(11(10)13)9-6-4-3-5-7-9/h3-8H,2,13H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 231.25100 |
|---|---|
| CAS: | 16078-71-0 |
| Flash_Point: | 186.7ºC |
| MF: | C12H13N3O2 |
| Symbol: | Warning |
| Bolling_Point: | 385.1ºC at 760mmHg |
| Melting_Point: | 98-100 °C(lit.) |
| Product_Name: | Ethyl 5-amino-1-phenyl-1H-pyrazole-4-carboxylate |
| Density: | 1.25g/cm3 |
| FW: | 231.25100 |
|---|---|
| MF: | C12H13N3O2 |
| Flash_Point: | 186.7ºC |
| Refractive_Index: | 1.609 |
| Vapor_Pressure: | 3.9E-06mmHg at 25°C |
| Bolling_Point: | 385.1ºC at 760mmHg |
| Exact_Mass: | 231.10100 |
| PSA: | 70.14000 |
| Computational_Chemistry: | ['1. XlogP :23 ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :4 ', '4. Rotatable Bond Count :4 ', '5. Isotope Atom Count :4 ', '6. TPSA 701 ', '7. Heavy Atom Count :17 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :267 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Molecular_Structure: | ['分子性质数据 ', '1 . Molar refractive index 6372 ', '2 . Molar volume (m3/mol)1839 ', '3 . Parachor (902K)4864 ', '4 . Surface tension 488 ', '5 . Polarizability 2526'] |
| LogP: | 2.21240 |
| Melting_Point: | 98-100 °C(lit.) |
| Density: | 1.25g/cm3 |
| More_Info: | ['1. Appearance Unknow ', '2. Density(g/mL,25/4℃)Unknow ', '3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)98-100 ', '5. Boiling point(ºC,Atmospheric pressure)Unknow ', '6. Boiling point(ºC,52kPa)Unknow ', '7. Refractive indexUnknow ', '8. Flash point(ºC)Unknow ', '9. Specific rotation(º)Unknow ', '10. Spontaneous ignition point or ignition temperature(ºC)Unknow ', '11. Vapor pressure(kPa,25ºC)Unknow ', '12. Saturated vapor pressure(kPa,60ºC)Unknow ', '13. Combustion heat(KJ/mol)Unknow ', '14. Critical temperature(ºC)Unknow ', '15. Critical pressure(KPa)Unknow ', '16. Oil-water(Octanol /Water )Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion(%,V/V)Unknow ', '18. Lower limit of explosion(%,V/V)Unknow ', '19. Solubility Unknow'] |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| RTECS: | UQ6392025 |
| HS_Code: | 2933199090 |
| Symbol: | Warning |
| Risk_Statements(EU): | R22;R36/37/38 |
| WGK_Germany: | 3 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn:Harmful; |