3-(6-Chloro-pyridin-3-yl)-acrylic acid ethyl ester
Catalog No: FT-0678250
CAS No: 159153-39-6
- Chemical Name: 3-(6-Chloro-pyridin-3-yl)-acrylic acid ethyl ester
- Molecular Formula: C10H10ClNO2
- Molecular Weight: 211.64
- InChI Key: FHRIBCCVJCCJCZ-GQCTYLIASA-N
- InChI: InChI=1S/C10H10ClNO2/c1-2-14-10(13)6-4-8-3-5-9(11)12-7-8/h3-7H,2H2,1H3/b6-4+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 211.64500 |
| Density: | 1.229g/cm3 |
| CAS: | 159153-39-6 |
| Bolling_Point: | 325.4ºC at 760mmHg |
| Product_Name: | ethyl (E)-3-(6-chloropyridin-3-yl)prop-2-enoate |
| Melting_Point: | N/A |
| Flash_Point: | 150.6ºC |
| MF: | C10H10ClNO2 |
| Density: | 1.229g/cm3 |
|---|---|
| LogP: | 2.31130 |
| Flash_Point: | 150.6ºC |
| Refractive_Index: | 1.566 |
| FW: | 211.64500 |
| PSA: | 39.19000 |
| MF: | C10H10ClNO2 |
| Bolling_Point: | 325.4ºC at 760mmHg |
| Vapor_Pressure: | 0mmHg at 25°C |
| Exact_Mass: | 211.04000 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)