![2,3-Dihydrothieno[3,4-b][1,4]dithiine (CAS: 158962-92-6) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0697763.png "2,3-Dihydrothieno[3,4-b][1,4]dithiine chemical structure")
2,3-Dihydrothieno[3,4-b][1,4]dithiine
Catalog No: FT-0697763
CAS No: 158962-92-6
- Chemical Name: 2,3-Dihydrothieno[3,4-b][1,4]dithiine
- Molecular Formula: C6H6S3
- Molecular Weight: 174.3
- InChI Key: HPGNGICCHXRMIP-UHFFFAOYSA-N
- InChI: InChI=1S/C6H6S3/c1-2-9-6-4-7-3-5(6)8-1/h3-4H,1-2H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 174.307 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 158962-92-6 |
| Bolling_Point: | 288.7±29.0 °C at 760 mmHg |
| Product_Name: | 2,3-Dihydrothieno[3,4-b][1,4]dithiine |
| Melting_Point: | N/A |
| Flash_Point: | 128.4±24.3 °C |
| MF: | C6H6S3 |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 2.70 |
| Flash_Point: | 128.4±24.3 °C |
| Refractive_Index: | 1.706 |
| FW: | 174.307 |
| PSA: | 78.84000 |
| MF: | C6H6S3 |
| Bolling_Point: | 288.7±29.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 173.963165 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-