Ethyl 2-methylquinoline-3-carboxylate
Catalog No: FT-0683901
CAS No: 15785-08-7
- Chemical Name: Ethyl 2-methylquinoline-3-carboxylate
- Molecular Formula: C13H13NO2
- Molecular Weight: 215.25
- InChI Key: DUBPJEDOCJXVKG-UHFFFAOYSA-N
- InChI: InChI=1S/C13H13NO2/c1-3-16-13(15)11-8-10-6-4-5-7-12(10)14-9(11)2/h4-8H,3H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 215.248 |
| Density: | 1.1±0.1 g/cm3 |
| CAS: | 15785-08-7 |
| Bolling_Point: | 308.7±22.0 °C at 760 mmHg |
| Product_Name: | Ethyl 2-methyl-3-quinolinecarboxylate |
| Melting_Point: | N/A |
| Flash_Point: | 140.5±22.3 °C |
| MF: | C13H13NO2 |
| Density: | 1.1±0.1 g/cm3 |
|---|---|
| LogP: | 3.20 |
| Flash_Point: | 140.5±22.3 °C |
| Refractive_Index: | 1.592 |
| FW: | 215.248 |
| PSA: | 39.19000 |
| MF: | C13H13NO2 |
| Bolling_Point: | 308.7±22.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Exact_Mass: | 215.094635 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H318 |
| Symbol: | Danger |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)