4-NITROSODIPHENYLAMINE
Catalog No: FT-0619298
CAS No: 156-10-5
- Molecular Formula: 198.22
- Formula Weight: C12H10N2O
- Inchl Key: OIJHFHYPXWSVPF-UHFFFAOYSA-N
- Inchl: InChI=1S/C12H10N2O/c15-14-12-8-6-11(7-9-12)13-10-4-2-1-3-5-10/h1-9,13H
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 144 °C (dec.)(lit.) |
|---|---|
| CAS: | 156-10-5 |
| MF: | C12H10N2O |
| Flash_Point: | 169.5ºC |
| Product_Name: | 4-Nitrosodiphenylamine |
| Density: | 1.12g/cm3 |
| FW: | 198.22100 |
| Bolling_Point: | 356.7ºC at 760 mmHg |
| Refractive_Index: | 1.596 |
|---|---|
| Vapor_Pressure: | 2.86E-05mmHg at 25°C |
| Flash_Point: | 169.5ºC |
| LogP: | 3.90110 |
| Bolling_Point: | 356.7ºC at 760 mmHg |
| FW: | 198.22100 |
| PSA: | 41.46000 |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :3 ', '4. Rotatable Bond Count :2 ', '5. Isotope Atom Count :3 ', '6. TPSA 415 ', '7. Heavy Atom Count :15 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :194 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 144 °C (dec.)(lit.) |
| MF: | C12H10N2O |
| Exact_Mass: | 198.07900 |
| Molecular_Structure: | ['1 . Molar refractive index 5970 ', '2 . Molar volume 1754 ', '3 . Parachor （902K）4532 ', '4 . Surface tension : 445 ', '5 . Dielectric constant 无可用 ', '6 偶极距（10 -24cm 3）无可用 ', '7 . Polarizability 2367'] |
| Density: | 1.12g/cm3 |
| Hazard_Class: | 6.1(b) |
|---|---|
| Risk_Statements(EU): | R22:Harmful if swallowed. R36/38:Irritating to eyes and skin . |
| WGK_Germany: | 3 |
| RTECS: | JK0175000 |
| RIDADR: | 2811 |
| Hazard_Codes: | Xn |
| HS_Code: | 2921440000 |
| Safety_Statements: | S26-S36/37 |
| Packing_Group: | III |
