1,2,4,5-TETRAKIS(BROMOMETHYL)BENZENE
Catalog No: FT-0637225
CAS No: 15442-91-8
- Molecular Formula: 449.8
- Formula Weight: C10H10Br4
- Inchl Key: UTXIKCCNBUIWPT-UHFFFAOYSA-N
- Inchl: InChI=1S/C10H10Br4/c11-3-7-1-8(4-12)10(6-14)2-9(7)5-13/h1-2H,3-6H2
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 15442-91-8 |
| Flash_Point: | 194.7ºC |
| Product_Name: | 1,2,4,5-Tetrakis(bromomethyl)benzene |
| Bolling_Point: | 408.7ºC at 760mmHg |
| FW: | 449.80200 |
| Melting_Point: | 159-161 °C(lit.) |
| MF: | C10H10Br4 |
| Density: | 2.168g/cm3 |
| Refractive_Index: | 1.663 |
|---|---|
| Vapor_Pressure: | 1.62E-06mmHg at 25°C |
| Flash_Point: | 194.7ºC |
| LogP: | 5.26620 |
| Bolling_Point: | 408.7ºC at 760mmHg |
| FW: | 449.80200 |
| More_Info: | ['1. Appearance Unknow ', '2. Density（g/mL,25/4℃）Unknow ', '3. Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4. Melting point（ºC）159-161 ', '5. Boiling point（ºC,Atmospheric pressure）Unknow ', '6. Boiling point（ºC,52kPa）Unknow ', '7. Refractive indexUnknow ', '8. Flash point（ºC）Unknow ', '9. Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Unknow'] |
| Computational_Chemistry: | ['1. XlogP :42 ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :0 ', '4. Rotatable Bond Count :4 ', '5. Isotope Atom Count :N/A ', '6. TPSA 0 ', '7. Heavy Atom Count :14 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :128 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 159-161 °C(lit.) |
| MF: | C10H10Br4 |
| Exact_Mass: | 445.75200 |
| Molecular_Structure: | ['五分子性质数据 ', '1 . Molar refractive index 7684 ', '2 . Molar volume （m3/mol）2074 ', '3 . Parachor （902K）5630 ', '4 . Surface tension 543 ', '5 . Polarizability 3046'] |
| Density: | 2.168g/cm3 |
| Symbol: | GHS05, GHS07 |
|---|---|
| RIDADR: | UN 3261 8/PG 2 |
| HS_Code: | 2903999090 |
| Packing_Group: | III |
| Hazard_Class: | 8 |
| Risk_Statements(EU): | R34 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard_Codes: | C: Corrosive; |
| Warning_Statement: | P261-P280-P305 + P351 + P338-P310 |
| Safety_Statements: | H314-H335 |
