2-CHLORO-6-FLUOROBENZYLAMINE
Catalog No: FT-0611859
CAS No: 15205-15-9
- Molecular Formula: 159.59
- Formula Weight: C7H7ClFN
- Inchl Key: GVULSXIBCHPJEH-UHFFFAOYSA-N
- Inchl: InChI=1S/C7H7ClFN/c8-6-2-1-3-7(9)5(6)4-10/h1-3H,4,10H2
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 159.58900 |
|---|---|
| CAS: | 15205-15-9 |
| Flash_Point: | 82 °C |
| MF: | C7H7ClFN |
| Symbol: | Danger |
| Bolling_Point: | 9193°C20mm Hg |
| Melting_Point: | N/A |
| Product_Name: | 2-chloro-6-fluorobenzylamine |
| Density: | 1.24g/mL20°C |
| FW: | 159.58900 |
|---|---|
| MF: | C7H7ClFN |
| Refractive_Index: | n20/D 1.539 |
| Vapor_Pressure: | 0.186mmHg at 25°C |
| Bolling_Point: | 9193°C20mm Hg |
| Exact_Mass: | 159.02500 |
| PSA: | 26.02000 |
| Computational_Chemistry: | ['1. XlogP :15 ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :2 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count :N/A ', '6. TPSA 26 ', '7. Heavy Atom Count :10 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :110 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Molecular_Structure: | ['五分子性质数据 ', '1 . Molar refractive index 3959 ', '2 . Molar volume （m3/mol）1255 ', '3 . Parachor （902K）3161 ', '4 . Surface tension 401 ', '5 . Polarizability 1569'] |
| LogP: | 2.63810 |
| Flash_Point: | 82 °C |
| Density: | 1.24g/mL20°C |
| More_Info: | ['1. Appearance Liquid ', '2. Density（g/mL,25/4℃）124 ', '3. Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4. Melting point（ºC）Unknow ', '5. Boiling point（ºC,Atmospheric pressure）9193°C20mm Hg ', '6. Boiling point（ºC,52kPa）Unknow ', '7. Refractive index1539 ', '8. Flash point（ºC）82 ', '9. Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Unknow'] |
| Personal_Protective_Equipment: | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| HS_Code: | 2921499090 |
| Symbol: | Danger |
| Risk_Statements(EU): | R34 |
| WGK_Germany: | 3 |
| Warning_Statement: | P280-P305 + P351 + P338-P310 |
| Packing_Group: | III |
| Safety_Statements: | H314 |
| RIDADR: | UN 2735 8/PG 2 |
| Hazard_Codes: | C: Corrosive; |
| Hazard_Class: | 8 |
Related Products
(5E)-5-(3-Ethoxy-2-hydroxybenzylidene)-2-mercapto-1,3-thiazol-4(5H)-one
