4-Morpholinecarbonyl chloride
Catalog No: FT-0658972
CAS No: 15159-40-7
- Chemical Name: 4-Morpholinecarbonyl chloride
- Molecular Formula: C5H8ClNO2
- Molecular Weight: 149.57 g/mol
- InChI Key: XMWFMEYDRNJSOO-UHFFFAOYSA-N
- InChI: InChI=1S/C5H8ClNO2/c6-5(8)7-1-3-9-4-2-7/h1-4H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 149.576 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 15159-40-7 |
| Bolling_Point: | 238.7±0.0 °C at 760 mmHg |
| Product_Name: | 4-(Chloroformyl)morpholine |
| Melting_Point: | N/A |
| Flash_Point: | 113.9±24.3 °C |
| MF: | C5H8ClNO2 |
| Molecular_Structure: | ['五分子性质数据 ', '1 . Molar refractive index 3304 ', '2 . Molar volume (m3/mol)1146 ', '3 . Parachor (902K)2913 ', '4 . Surface tension 416 ', '5 . Polarizability 1309'] |
|---|---|
| LogP: | -0.54 |
| Flash_Point: | 113.9±24.3 °C |
| Refractive_Index: | 1.488 |
| FW: | 149.576 |
| Density: | 1.3±0.1 g/cm3 |
| Bolling_Point: | 238.7±0.0 °C at 760 mmHg |
| Computational_Chemistry: | ['1. XlogP :04 ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :2 ', '4. Rotatable Bond Count :0 ', '5. Isotope Atom Count :N/A ', '6. TPSA 295 ', '7. Heavy Atom Count :9 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :112 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| PSA: | 29.54000 |
| MF: | C5H8ClNO2 |
| More_Info: | ['1. Appearance Unknow ', '2. Density(g/mL,25/4℃)1282 ', '3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)Unknow ', '5. Boiling point(ºC,Atmospheric pressure)137-138 ', '6. Boiling point(ºC,52kPa)Unknow ', '7. Refractive index1498 ', '8. Flash point(ºC)230 ', '9. Specific rotation(º)Unknow ', '10. Spontaneous ignition point or ignition temperature(ºC)Unknow ', '11. Vapor pressure(kPa,25ºC)Unknow ', '12. Saturated vapor pressure(kPa,60ºC)Unknow ', '13. Combustion heat(KJ/mol)Unknow ', '14. Critical temperature(ºC)Unknow ', '15. Critical pressure(KPa)Unknow ', '16. Oil-water(Octanol /Water )Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion(%,V/V)Unknow ', '18. Lower limit of explosion(%,V/V)Unknow ', '19. Solubility Unknow'] |
| Vapor_Pressure: | 0.0±0.4 mmHg at 25°C |
| Exact_Mass: | 149.024353 |
| Hazard_Codes: | Xn:Harmful; |
|---|---|
| Symbol: | Warning |
| Packing_Group: | II |
| Hazard_Class: | 8 |
| Supplementary_Hazard_Statement: | Reacts violently with water. |
| Warning_Statement: | P281-P305 + P351 + P338 |
| HS_Code: | 2934999090 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Risk_Statements(EU): | R14;R36/38;R40 |
| Safety_Statements: | S26-S30-S36-S38 |
| RIDADR: | UN 3265 8/PG 2 |
| WGK_Germany: | 3 |