4-Biphenylcarbonyl chloride
Catalog No: FT-0619398
CAS No: 14002-51-8
- Molecular Formula: 216.66
- Formula Weight: C13H9ClO
- Inchl Key: JPVUWCPKMYXOKW-UHFFFAOYSA-N
- Inchl: InChI=1S/C13H9ClO/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05 |
|---|---|
| CAS: | 14002-51-8 |
| Flash_Point: | 158.4±15.2 °C |
| Product_Name: | 4-Biphenylcarbonyl chloride |
| Bolling_Point: | 337.1±21.0 °C at 760 mmHg |
| FW: | 216.663 |
| Melting_Point: | 110-112 °C(lit.) |
| MF: | C13H9ClO |
| Density: | 1.2±0.1 g/cm3 |
| Refractive_Index: | 1.590 |
|---|---|
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Flash_Point: | 158.4±15.2 °C |
| LogP: | 3.86 |
| Bolling_Point: | 337.1±21.0 °C at 760 mmHg |
| Water_Solubility: | HYDROLYSIS |
| PSA: | 17.07000 |
| Molecular_Structure: | ['1 . Molar refractive index 6108 ', '2 . Molar volume （m3/mol）1811 ', '3 . Parachor （902K）4644 ', '4 . Surface tension 432 ', '5 . Polarizability 2421'] |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :1 ', '4. Rotatable Bond Count :2 ', '5. Isotope Atom Count :N/A ', '6. TPSA 171 ', '7. Heavy Atom Count :15 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :213 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 110-112 °C(lit.) |
| MF: | C13H9ClO |
| Exact_Mass: | 216.034195 |
| FW: | 216.663 |
| Density: | 1.2±0.1 g/cm3 |
| More_Info: | ['1 . Appearance 结晶。 ', '2 . Density（g/mL,25/4℃）Unknow ', '3 . Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4 . Melting point（ºC） 112 ', '5 . Boiling point（ºC,Atmospheric pressure）Unknow ', '6 . Boiling point（ºC,52kPa）Unknow ', '7 . Refractive indexUnknow ', '8 . Flash point（ºC） Unknow ', '9 . Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility 对湿敏感。'] |
| Symbol: | GHS05 |
|---|---|
| Supplementary_Hazard_Statement: | Reacts violently with water. |
| RIDADR: | UN 3261 8/PG 2 |
| HS_Code: | 2916399090 |
| Packing_Group: | II |
| Hazard_Class: | 8 |
| Risk_Statements(EU): | R34 |
| WGK_Germany: | 3 |
| Hazard_Codes: | C:Corrosive; |
| Warning_Statement: | P280-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338-P305 + P351 + P338 + P310-P310 |
| Safety_Statements: | H314 |
