4'-[(2-n-Butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-(1,1'-biphenyl)-2-carbonitrile
Catalog No: FT-0601482
CAS No: 138401-24-8
- Chemical Name: 4'-[(2-n-Butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-(1,1'-biphenyl)-2-carbonitrile
- Molecular Formula: C25H27N3O
- Molecular Weight: 385.5
- InChI Key: KWEQEHOPDHARIA-UHFFFAOYSA-N
- InChI: InChI=1S/C25H27N3O/c1-2-3-10-23-27-25(15-6-7-16-25)24(29)28(23)18-19-11-13-20(14-12-19)22-9-5-4-8-21(22)17-26/h4-5,8-9,11-14H,2-3,6-7,10,15-16,18H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 4'-[(2-Butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-[1,1'-Biphenyl]-2-carbonitrile |
|---|---|
| Flash_Point: | 302.5±32.9 °C |
| Melting_Point: | N/A |
| FW: | 385.501 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 138401-24-8 |
| Bolling_Point: | 576.5±60.0 °C at 760 mmHg |
| MF: | C25H27N3O |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 4.64 |
| Flash_Point: | 302.5±32.9 °C |
| Refractive_Index: | 1.621 |
| FW: | 385.501 |
| PSA: | 56.46000 |
| MF: | C25H27N3O |
| Bolling_Point: | 576.5±60.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.6 mmHg at 25°C |
| Exact_Mass: | 385.215424 |
| Hazard_Codes: | N:Dangerousfortheenvironment; |
|---|---|
| Risk_Statements(EU): | R50/53 |
| HS_Code: | 2933990090 |
| Safety_Statements: | S60-S61 |