(6S)-6-(Chloromethyl)-5,6-dihydro-2H-pyran-2-one
Catalog No: FT-0694214
CAS No: 135999-61-0
- Chemical Name: (6S)-6-(Chloromethyl)-5,6-dihydro-2H-pyran-2-one
- Molecular Formula: C6H7ClO2
- Molecular Weight: 146.57
- InChI Key: NVMBKTXDBXNDQK-YFKPBYRVSA-N
- InChI: InChI=1S/C6H7ClO2/c7-4-5-2-1-3-6(8)9-5/h1,3,5H,2,4H2/t5-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 146.57200 |
| Density: | 1.224g/cm3 |
| CAS: | 135999-61-0 |
| Bolling_Point: | 300.2ºC at 760 mmHg |
| Product_Name: | (s)-6-chloromethyl-5,6-dihydro-pyran-2-one |
| Melting_Point: | N/A |
| Flash_Point: | 162.1ºC |
| MF: | C6H7ClO2 |
| Density: | 1.224g/cm3 |
|---|---|
| LogP: | 1.09690 |
| Flash_Point: | 162.1ºC |
| Refractive_Index: | 1.478 |
| FW: | 146.57200 |
| PSA: | 26.30000 |
| MF: | C6H7ClO2 |
| Bolling_Point: | 300.2ºC at 760 mmHg |
| Vapor_Pressure: | 0.00114mmHg at 25°C |
| Exact_Mass: | 146.01300 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xn |
| Risk_Statements(EU): | R22 |
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2932999099 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)