 
                                         
                                        Valacyclovir hydrochloride
Catalog No: FT-0631117
CAS No: 124832-27-5
- Chemical Name: Valacyclovir hydrochloride
- Molecular Formula: C13H21ClN6O4
- Molecular Weight: 360.8
- InChI Key: ZCDDBUOENGJMLV-QRPNPIFTSA-N
- InChI: InChI=1S/C13H20N6O4.ClH/c1-7(2)8(14)12(21)23-4-3-22-6-19-5-16-9-10(19)17-13(15)18-11(9)20;/h5,7-8H,3-4,6,14H2,1-2H3,(H3,15,17,18,20);1H/t8-;/m0./s1
| Assay | Pack Size | Price | Stock | Action | 
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A | 
| Symbol: | GHS07 | 
|---|---|
| CAS: | 124832-27-5 | 
| Flash_Point: | 309.7ºC | 
| Product_Name: | Valacyclovir hydrochloride | 
| Bolling_Point: | 588.4ºC at 760 mmHg | 
| FW: | 360.797 | 
| Melting_Point: | 170-172ºC | 
| MF: | C13H21ClN6O4 | 
| Density: | 1.55g/cm3 | 
| Refractive_Index: | 1.673 | 
|---|---|
| Vapor_Pressure: | 7.95E-14mmHg at 25°C | 
| Flash_Point: | 309.7ºC | 
| LogP: | 1.28590 | 
| Bolling_Point: | 588.4ºC at 760 mmHg | 
| FW: | 360.797 | 
| PSA: | 151.14000 | 
| Melting_Point: | 170-172ºC | 
| MF: | C13H21ClN6O4 | 
| Exact_Mass: | 360.131287 | 
| Density: | 1.55g/cm3 | 
| Symbol: | GHS07 | 
|---|---|
| Risk_Statements(EU): | R36/37/38 | 
| HS_Code: | 2933990090 | 
| RIDADR: | NONH for all modes of transport | 
| Hazard_Codes: | Xi: Irritant; | 
| Warning_Statement: | P301 + P312 + P330 | 
| Safety_Statements: | H302 | 
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)
