(R)-3-AMINO-1-CBZ-PYRROLIDINE
Catalog No: FT-0603861
CAS No: 122536-73-6
- Chemical Name: (R)-3-AMINO-1-CBZ-PYRROLIDINE
- Molecular Formula: C12H16N2O2
- Molecular Weight: 220.27
- InChI Key: FPXJNSKAXZNWMQ-LLVKDONJSA-N
- InChI: InChI=1S/C12H16N2O2/c13-11-6-7-14(8-11)12(15)16-9-10-4-2-1-3-5-10/h1-5,11H,6-9,13H2/t11-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 220.268 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 122536-73-6 |
| Bolling_Point: | 351.7±42.0 °C at 760 mmHg |
| Product_Name: | (R)-1-Cbz-3-aminopyrrolidine |
| Melting_Point: | N/A |
| Flash_Point: | 166.5±27.9 °C |
| MF: | C12H16N2O2 |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 0.89 |
| Flash_Point: | 166.5±27.9 °C |
| Refractive_Index: | 1.571 |
| FW: | 220.268 |
| PSA: | 55.56000 |
| MF: | C12H16N2O2 |
| Bolling_Point: | 351.7±42.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Exact_Mass: | 220.121185 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| Hazard_Codes: | Xn |
| Risk_Statements(EU): | R22 |
| Safety_Statements: | S26 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
| WGK_Germany: | 3 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)