4-Bromo-3-fluorophenol
Catalog No: FT-0612033
CAS No: 121219-03-2
- Chemical Name: 4-Bromo-3-fluorophenol
- Molecular Formula: C6H4BrFO
- Molecular Weight: 191
- InChI Key: MRQYTJXVULSNIS-UHFFFAOYSA-N
- InChI: InChI=1S/C6H4BrFO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 190.998 |
| Density: | 1.8±0.1 g/cm3 |
| CAS: | 121219-03-2 |
| Bolling_Point: | 231.4±20.0 °C at 760 mmHg |
| Product_Name: | 4-Bromo-3-fluorophenol |
| Melting_Point: | 71.5ºC |
| Flash_Point: | 93.8±21.8 °C |
| MF: | C6H4BrFO |
| LogP: | 2.85 |
|---|---|
| Flash_Point: | 93.8±21.8 °C |
| Refractive_Index: | 1.576 |
| FW: | 190.998 |
| Bolling_Point: | 231.4±20.0 °C at 760 mmHg |
| Density: | 1.8±0.1 g/cm3 |
| Melting_Point: | 71.5ºC |
| PSA: | 20.23000 |
| Exact_Mass: | 189.942947 |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| MF: | C6H4BrFO |
| Hazard_Codes: | Xi:Irritant; |
|---|---|
| Warning_Statement: | P280-P305 + P351 + P338 |
| Risk_Statements(EU): | R20/21/22 |
| Safety_Statements: | S26 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2908199090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)