![2-BROMO-1-(5-CHLORO-3-METHYLBENZO[B]THIOPHEN-2-YL)ETHAN-1-ONE (CAS: 118337-33-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0611337.png "2-BROMO-1-(5-CHLORO-3-METHYLBENZO[B]THIOPHEN-2-YL)ETHAN-1-ONE chemical structure")
2-BROMO-1-(5-CHLORO-3-METHYLBENZO[B]THIOPHEN-2-YL)ETHAN-1-ONE
Catalog No: FT-0611337
CAS No: 118337-33-0
- Molecular Formula: C11H9BrOS
- Molecular Weight: 269.16
- InChI Key: PIQSJBQPXDKSHF-UHFFFAOYSA-N
- InChI: InChI=1S/C11H9BrOS/c1-7-8-4-2-3-5-10(8)14-11(7)9(13)6-12/h2-5H,6H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 94-97ºC |
|---|---|
| CAS: | 118337-33-0 |
| MF: | C11H9BrOS |
| Flash_Point: | 174.6ºC |
| Product_Name: | 2-bromo-1-(3-methyl-1-benzothiophen-2-yl)ethanone |
| Density: | 1.546 g/cm3 |
| FW: | 269.15800 |
| Bolling_Point: | 365.2ºC at 760 mmHg |
| Refractive_Index: | 1.676 |
|---|---|
| Vapor_Pressure: | 1.73E-06mmHg at 25°C |
| Flash_Point: | 174.6ºC |
| LogP: | 3.78730 |
| Bolling_Point: | 365.2ºC at 760 mmHg |
| FW: | 269.15800 |
| PSA: | 45.31000 |
| Melting_Point: | 94-97ºC |
| MF: | C11H9BrOS |
| Exact_Mass: | 267.95600 |
| Density: | 1.546 g/cm3 |
| RIDADR: | UN 3261 |
|---|---|
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2934999090 |
| Risk_Statements(EU): | R34 |
| Safety_Statements: | 26-36/37/39-45 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)