2-Chloro-4,5-difluorobenzoic acid
Catalog No: FT-0611747
CAS No: 110877-64-0
- Molecular Formula: 192.55
- Formula Weight: C7H3ClF2O2
- Inchl Key: CGFMLBSNHNWJAW-UHFFFAOYSA-N
- Inchl: InChI=1S/C7H3ClF2O2/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2H,(H,11,12)
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 110877-64-0 |
| Flash_Point: | 119.4±25.9 °C |
| Product_Name: | 2-Chloro-4,5-difluorobenzoic acid |
| Bolling_Point: | 273.8±35.0 °C at 760 mmHg |
| FW: | 192.547 |
| Melting_Point: | 103-106 °C(lit.) |
| MF: | C7H3ClF2O2 |
| Density: | 1.6±0.1 g/cm3 |
| Refractive_Index: | 1.535 |
|---|---|
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Flash_Point: | 119.4±25.9 °C |
| LogP: | 1.90 |
| Bolling_Point: | 273.8±35.0 °C at 760 mmHg |
| Water_Solubility: | 5.0 g/L (20 ºC) |
| PSA: | 37.30000 |
| Molecular_Structure: | ['1. Molar refractive index 3806 ', '2. Molar volume 1223 ', '3. Parachor （902K）3195 ', '4. Surface tension 465 ', '5. Dielectric constant N/A ', '6. Polarizability 1509 ', '7. Single isotope mass 191978963 Da ', '8. Nominal mass 192 Da ', '9. Average mass 1925473 Da'] |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :4 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count :N/A ', '6. TPSA 373 ', '7. Heavy Atom Count :12 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :188 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 103-106 °C(lit.) |
| MF: | C7H3ClF2O2 |
| Exact_Mass: | 191.978958 |
| FW: | 192.547 |
| Density: | 1.6±0.1 g/cm3 |
| More_Info: | ['1 . Melting point（℃）103~106 ', '2 . Boiling point（℃）258 ', '3 Water 溶性（℃）50g/L'] |
| Symbol: | GHS05, GHS07 |
|---|---|
| Risk_Statements(EU): | R21/22;R41;R43 |
| HS_Code: | 4002191900 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn:Harmful; |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H315-H318-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)