8-FLUORO-2-METHYL-4-QUINOLINOL
Catalog No: FT-0621535
CAS No: 5288-22-2
- Molecular Formula: 177.17
- Formula Weight: C10H8FNO
- Inchl Key: LLUXFHIYAWGJGO-UHFFFAOYSA-N
- Inchl: InChI=1S/C10H8FNO/c1-6-5-9(13)7-3-2-4-8(11)10(7)12-6/h2-5H,1H3,(H,12,13)
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 177.17500 |
| Density: | 1.305 g/cm3 |
| CAS: | 5288-22-2 |
| Bolling_Point: | 316.7ºC at 760 mmHg |
| Product_Name: | 8-fluoro-2-methyl-1H-quinolin-4-one |
| Melting_Point: | N/A |
| Flash_Point: | 145.3ºC |
| MF: | C10H8FNO |
| Density: | 1.305 g/cm3 |
|---|---|
| LogP: | 2.38790 |
| Flash_Point: | 145.3ºC |
| Refractive_Index: | 1.64 |
| FW: | 177.17500 |
| PSA: | 33.12000 |
| MF: | C10H8FNO |
| Bolling_Point: | 316.7ºC at 760 mmHg |
| Exact_Mass: | 177.05900 |
| Hazard_Codes: | Xi |
|---|---|
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933499090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)