5-BROMO-2,1,3-BENZOTHIADIAZOLE
Catalog No: FT-0620065
CAS No: 1753-75-9
- Molecular Formula: 215.07
- Formula Weight: C6H3BrN2S
- Inchl Key: LLCRUZDFDGTAAN-UHFFFAOYSA-N
- Inchl: InChI=1S/C6H3BrN2S/c7-4-1-2-5-6(3-4)9-10-8-5/h1-3H
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 215.07000 |
| Density: | 1.859g/cm3 |
| CAS: | 1753-75-9 |
| Bolling_Point: | 272.2ºC at 760mmHg |
| Product_Name: | 5-Bromo-2,1,3-benzothiadiazole |
| Melting_Point: | 51-53ºC |
| Flash_Point: | 118.4ºC |
| MF: | C6H3BrN2S |
| Density: | 1.859g/cm3 |
|---|---|
| LogP: | 2.45380 |
| Flash_Point: | 118.4ºC |
| Melting_Point: | 51-53ºC |
| FW: | 215.07000 |
| PSA: | 54.02000 |
| Exact_Mass: | 213.92000 |
| MF: | C6H3BrN2S |
| Bolling_Point: | 272.2ºC at 760mmHg |
| Vapor_Pressure: | 0.0103mmHg at 25°C |
| Refractive_Index: | 1.733 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | 26-36/37/39 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)